1,1'-Biphenyl,4-fluoro-4'-nitro structure
|
Common Name | 1,1'-Biphenyl,4-fluoro-4'-nitro | ||
|---|---|---|---|---|
| CAS Number | 398-24-3 | Molecular Weight | 217.19600 | |
| Density | 1.271g/cm3 | Boiling Point | 337.3ºC at 760mmHg | |
| Molecular Formula | C12H8FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.8ºC | |
| Name | 1-(4-fluorophenyl)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 337.3ºC at 760mmHg |
| Molecular Formula | C12H8FNO2 |
| Molecular Weight | 217.19600 |
| Flash Point | 157.8ºC |
| Exact Mass | 217.05400 |
| PSA | 45.82000 |
| LogP | 3.92410 |
| Index of Refraction | 1.586 |
| InChIKey | GMPGAPATPBXNSX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(F)cc2)cc1 |
| HS Code | 2904909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-fluoro-4'-nitro-1,1-biphenyl |
| 4'-fluoro-4-nitro-biphenyl |
| 4-nitro-4'-fluorobiphenyl |