Oxadiargyl structure
|
Common Name | Oxadiargyl | ||
|---|---|---|---|---|
| CAS Number | 39807-15-3 | Molecular Weight | 341.189 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 429.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H14Cl2N2O3 | Melting Point | 131℃ | |
| MSDS | Chinese USA | Flash Point | 213.6±31.5 °C | |
| Symbol |
GHS08, GHS09 |
Signal Word | Warning | |
Use of OxadiargylOxadiargyl is a protoporphyrinogen oxidase inhibitor and is used as a herbicide in China. |
| Name | oxadiargyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.6±55.0 °C at 760 mmHg |
| Melting Point | 131℃ |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.189 |
| Flash Point | 213.6±31.5 °C |
| Exact Mass | 340.038147 |
| PSA | 57.26000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | DVOODWOZJVJKQR-UHFFFAOYSA-N |
| SMILES | C#CCOc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl |
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H361d-H373-H410 |
| Precautionary Statements | P201-P273-P308 + P313-P391-P501 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N |
| Risk Phrases | R48/22 |
| Safety Phrases | 36/37-46-60-61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | RO0907700 |
| HS Code | 2934999028 |
| HS Code | 2934999028 |
|---|---|
| Summary | 2934999028. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:S(import or export registration certificate for pesticides). MFN tariff:6.5%. General tariff:20.0% |
|
Novel unbreakable solid-phase microextraction fibers on stainless steel wire and application for the determination of oxadiargyl in environmental and agricultural samples in combination with gas chromatography-mass spectrometry.
Talanta 128 , 231-6, (2014) Sol-gel based solid-phase microextraction fibers supported by a stainless steel wire were fabricated and employed for GC-MS determination of oxadiargyl in real samples. The fibers were based on four c... |
| 5-tert-Butyl-3-[2,4-dichloro-5-(prop-2-yn-1-yloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one |
| 1,3,4-Oxadiazol-2(3H)-one, 3-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)- (9CI) |
| 3-(2,4-Dichloro-5-(2-propynyloxy)phenyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
| 5-tert-Butyl-3-[2,4-dichloro-5-(prop-2-ynyloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one |
| 1,3,4-Oxadiazol-2(3H)-one, 3-[2,4-dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(1,1-dimethylethyl)- |
| 3-[2,4-Dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one |
| 5-tert-Butyl-3-[2,4-dichlor-5-(prop-2-in-1-yloxy)phenyl]-1,3,4-oxadiazol-2(3H)-on |
| 3-[2,4-dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
| 5-tert-butyl-3-(2,4-dichloro-5-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-one |
| Oxadiargyl |
| 1,3,4-Oxadiazol-2(3H)-one, 3-(2,4-dichloro-5-(2-propynyloxy)phenyl)-5-(1,1-dimethylethyl)- |
| 5-tert-Butyl-3-(2,4-dichloro-5-propargyloxyphenyl)-1,3,4-oxadiazol-2(3H)-one |
| 5-tert-Butyl-3-[2,4-dichloro-5-(2-propinyloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one |