5,6-dichloro-2-(chloromethyl)-1H-benzimidazole structure
|
Common Name | 5,6-dichloro-2-(chloromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 39811-03-5 | Molecular Weight | 235.49800 | |
| Density | 1.605g/cm3 | Boiling Point | 437.2ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.8ºC | |
| Name | 5,6-dichloro-2-(chloromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 437.2ºC at 760 mmHg |
| Molecular Formula | C8H5Cl3N2 |
| Molecular Weight | 235.49800 |
| Flash Point | 250.8ºC |
| Exact Mass | 233.95200 |
| PSA | 28.68000 |
| LogP | 3.60850 |
| Index of Refraction | 1.691 |
| InChIKey | IUNRBKGPVGKLNG-UHFFFAOYSA-N |
| SMILES | ClCc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
5,6-dichloro-2-... CAS#:39811-03-5 |
| Literature: Knobloch Chemische Berichte, 1958 , vol. 91, p. 2557,2560 |
|
~%
5,6-dichloro-2-... CAS#:39811-03-5 |
| Literature: Schering Corporation Patent: US2004/24002 A1, 2004 ; US 20040024002 A1 |
|
~%
5,6-dichloro-2-... CAS#:39811-03-5 |
| Literature: Lettre et al. Chemische Berichte, 1951 , vol. 84, p. 719,727 |
|
~%
5,6-dichloro-2-... CAS#:39811-03-5 |
| Literature: Lettre et al. Chemische Berichte, 1951 , vol. 84, p. 719,727 |
|
~%
5,6-dichloro-2-... CAS#:39811-03-5 |
| Literature: Knobloch Chemische Berichte, 1958 , vol. 91, p. 2557,2560 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-dichloro-2-chloromethyl-1H-benzoimidazole |
| 5,6-Dichlor-2-chlormethyl-benzimidazol |
| 5,6-Dichlor-2-chlormethyl-1H-benzimidazol |
| 2-Chloromethyl-5,6-dichlorobenzimidazole |
| BENZIMIDAZOLE,2-CHLOROMETHYL-5,6-DICHLORO |