Triisobutylphosphine sulfide
Triisobutylphosphine sulfide structure
|
Common Name | Triisobutylphosphine sulfide | ||
|---|---|---|---|---|
| CAS Number | 3982-87-4 | Molecular Weight | 234.382 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 288.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H27PS | Melting Point | 57-60ºC | |
| MSDS | N/A | Flash Point | 128.1±22.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tris(2-methylpropyl)-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.3±23.0 °C at 760 mmHg |
| Melting Point | 57-60ºC |
| Molecular Formula | C12H27PS |
| Molecular Weight | 234.382 |
| Flash Point | 128.1±22.6 °C |
| Exact Mass | 234.157104 |
| PSA | 41.90000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | MXRLZCWBOJMFJG-UHFFFAOYSA-N |
| SMILES | CC(C)CP(=S)(CC(C)C)CC(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/38 |
| Safety Phrases | 22-26-36 |
| WGK Germany | 3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:926-62-5
CAS#:7682-87-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tri-i-butylphosphine sulfide |
| Tris(2-methylpropyl)phosphine sulfide |
| Triisobutyl-phosphinsulfid |
| TIBPS |
| triisobutyl-phosphine sulfide |
| Triisobutylphosphine sulfide |
| Triisobutylphosphine sulphide |
| Phosphorane, tris(2-methylpropyl)-, sulfide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: LogP of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane is 3.07. |
| Q: What is the molecular formula of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: Molecular formula of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane is C12H27PS. |
| Q: What is the CAS number of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: CAS number of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane is 3982-87-4. |
| Q: What is the melting point of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: Melting point of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane is 57-60ºC. |
| Q: What is the boiling point of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: Boiling point of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane is 288.3±23.0 °C at 760 mmHg. |
| Q: What are the upstream materials of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: Related upstream materials(CAS) of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane: 926-62-5. |
| Q: What English synonyms does tris(2-methylpropyl)-sulfanylidene-λ5-phosphane have? |
| A: English synonyms of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane: tri-i-butylphosphine sulfide, Tris(2-methylpropyl)phosphine sulfide, Triisobutyl-phosphinsulfid, TIBPS, triisobutyl-phosphine sulfide, Triisobutylphosphine sulfide, Triisobutylphosphine sulphide, Phosphorane, tris(2-methylpropyl)-, sulfide. |
| Q: What are the downstream products of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: Related downstream products(CAS) of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane: 7682-87-3. |
| Q: What is the English name of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: The English name of tris(2-methylpropyl)-sulfanylidene-λ5-phosphane is tris(2-methylpropyl)-sulfanylidene-λ5-phosphane. |
| Q: What is the safety information for tris(2-methylpropyl)-sulfanylidene-λ5-phosphane? |
| A: Safety information for tris(2-methylpropyl)-sulfanylidene-λ5-phosphane: 22-26-36. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |