trimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,iodide structure
|
Common Name | trimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 3983-39-9 | Molecular Weight | 336.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17IN2O2 |
|---|---|
| Molecular Weight | 336.16900 |
| Exact Mass | 336.03300 |
| PSA | 44.65000 |
| LogP | 2.67660 |
| InChIKey | MIAARRZWMRMHIS-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cccc([N+](C)(C)C)c1.[I-] |
|
~%
trimethyl-[3-(m... CAS#:3983-39-9 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
| tri-N-methyl-3-methylcarbamoyloxy-anilinium,iodide |
| Tri-N-methyl-3-methylcarbamoyloxy-anilinium,Jodid |
| T-1152 |
| TL 1178 |
| Methiodide of N-methylurethane of 3-dimethylaminophenol |