4-methylbenzenesulfonate,tetramethylazanium structure
|
Common Name | 4-methylbenzenesulfonate,tetramethylazanium | ||
|---|---|---|---|---|
| CAS Number | 3983-91-3 | Molecular Weight | 245.339 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-methylbenzenesulfonate,tetramethylazaniumTetramethylammoniump-toluenesulfonate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 4-methylbenzenesulfonate,tetramethylazanium |
|---|---|
| Synonym | More Synonyms |
| Description | Tetramethylammoniump-toluenesulfonate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Molecular Formula | C11H19NO3S |
|---|---|
| Molecular Weight | 245.339 |
| Exact Mass | 245.108566 |
| PSA | 65.58000 |
| LogP | 2.30230 |
| InChIKey | FHVCZJGBXWNGIZ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| Tetramethylammonium toluene-p-sulphonate |
| EINECS 223-625-2 |
| tetramethylammonium tosylate |
| N,N,N-Trimethylmethanaminium 4-methylbenzenesulfonate |
| TetraMethylaMMoniuM p-Toluenesulfonate |