Di-iso-amyl phosphate
Di-iso-amyl phosphate structure
|
Common Name | Di-iso-amyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 3985-20-4 | Molecular Weight | 238.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H23O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diisoamylphosphoric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H23O4P |
|---|---|
| Molecular Weight | 238.26100 |
| Exact Mass | 238.13300 |
| PSA | 65.57000 |
| LogP | 3.21220 |
| InChIKey | PYKHKJJMHQLJOH-UHFFFAOYSA-N |
| SMILES | CC(C)CCOP(=O)(O)OCCC(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | F，T |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Diisoamylphosphorsaeure |
| Di-isopentyl-phosphorsaeure |
| phosphoric acid bis-(3-methyl-butyl) ester |
| Phosphorsaeure-diisopentylester |
| phosphoric acid diisopentyl ester |
| Diisopentyl-hydrogenphosphat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of diisoamylphosphoric acid? |
| A: LogP of diisoamylphosphoric acid is 3.21220. |
| Q: What is the CAS number of diisoamylphosphoric acid? |
| A: CAS number of diisoamylphosphoric acid is 3985-20-4. |
| Q: What is the molecular formula of diisoamylphosphoric acid? |
| A: Molecular formula of diisoamylphosphoric acid is C10H23O4P. |
| Q: What is the SMILES notation of diisoamylphosphoric acid? |
| A: SMILES notation of diisoamylphosphoric acid is CC(C)CCOP(=O)(O)OCCC(C)C. |
| Q: What is the polar surface area (PSA) of diisoamylphosphoric acid? |
| A: Polar surface area (PSA) of diisoamylphosphoric acid is 65.57000. |
| Q: What English synonyms does diisoamylphosphoric acid have? |
| A: English synonyms of diisoamylphosphoric acid: Diisoamylphosphorsaeure, Di-isopentyl-phosphorsaeure, phosphoric acid bis-(3-methyl-butyl) ester, Phosphorsaeure-diisopentylester, phosphoric acid diisopentyl ester, Diisopentyl-hydrogenphosphat. |
| Q: What is the InChIKey of diisoamylphosphoric acid? |
| A: InChIKey of diisoamylphosphoric acid is PYKHKJJMHQLJOH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of diisoamylphosphoric acid? |
| A: Molecular weight of diisoamylphosphoric acid is 238.26100. |
| Q: What is the English name of diisoamylphosphoric acid? |
| A: The English name of diisoamylphosphoric acid is diisoamylphosphoric acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |