(2-AMINOTHIOPHEN-3-YL)(4-BROMOPHENYL)METHANONE structure
|
Common Name | (2-AMINOTHIOPHEN-3-YL)(4-BROMOPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 399043-24-4 | Molecular Weight | 282.15600 | |
| Density | 1.607g/cm3 | Boiling Point | 446.1ºC at 760 mmHg | |
| Molecular Formula | C11H8BrNOS | Melting Point | 180-184ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 223.6ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | (2-aminothiophen-3-yl)-(4-bromophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.607g/cm3 |
|---|---|
| Boiling Point | 446.1ºC at 760 mmHg |
| Melting Point | 180-184ºC(lit.) |
| Molecular Formula | C11H8BrNOS |
| Molecular Weight | 282.15600 |
| Flash Point | 223.6ºC |
| Exact Mass | 280.95100 |
| PSA | 71.33000 |
| LogP | 3.90500 |
| Index of Refraction | 1.68 |
| InChIKey | UEAXJDFGNXSVSK-UHFFFAOYSA-N |
| SMILES | Nc1sccc1C(=O)c1ccc(Br)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H319-H334-H335 |
| Precautionary Statements | P261-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36/37/38-43 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-amino-3-(4-bromo benzoyl) thiophene |