[2-(dimethylaminomethyl)-2-ethyl-butyl] 2-hydroxy-2,2-diphenyl-acetate structure
|
Common Name | [2-(dimethylaminomethyl)-2-ethyl-butyl] 2-hydroxy-2,2-diphenyl-acetate | ||
|---|---|---|---|---|
| CAS Number | 39943-08-3 | Molecular Weight | 369.49700 | |
| Density | 1.077g/cm3 | Boiling Point | 447.2ºC at 760 mmHg | |
| Molecular Formula | C23H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | [2-[(dimethylamino)methyl]-2-ethylbutyl] 2-hydroxy-2,2-diphenylacetate |
|---|
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 447.2ºC at 760 mmHg |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.49700 |
| Flash Point | 224.3ºC |
| Exact Mass | 369.23000 |
| PSA | 49.77000 |
| LogP | 3.83370 |
| Index of Refraction | 1.545 |
| InChIKey | LHHMCPYOPXKWNW-UHFFFAOYSA-N |
| SMILES | CCC(CC)(COC(=O)C(O)(c1ccccc1)c1ccccc1)CN(C)C |
|
~%
[2-(dimethylami... CAS#:39943-08-3 |
| Literature: Newman; Broger; LaPidus; Tye Journal of medicinal chemistry, 1972 , vol. 15, # 10 p. 1003 - 1006 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |