Methyl benzilate structure
|
Common Name | Methyl benzilate | ||
|---|---|---|---|---|
| CAS Number | 76-89-1 | Molecular Weight | 242.27000 | |
| Density | 1.189 g/cm3 | Boiling Point | 187 °C | |
| Molecular Formula | C15H14O3 | Melting Point | 73 °C | |
| MSDS | N/A | Flash Point | 187°C/13mm | |
| Name | Methyl benzilate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189 g/cm3 |
|---|---|
| Boiling Point | 187 °C |
| Melting Point | 73 °C |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 187°C/13mm |
| Exact Mass | 242.09400 |
| PSA | 46.53000 |
| LogP | 2.09550 |
| Index of Refraction | 1.579 |
| InChIKey | LJFIHTFNTGQZJL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)(c1ccccc1)c1ccccc1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S22-S24/25 |
| HS Code | 2918199010 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199010 |
|---|---|
| Summary | 2918199010. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies). MFN tariff:6.5%. General tariff:30.0% |
| methyl 2-hydroxy-2,2-diphenylacetate |
| EINECS 200-991-1 |
| MFCD00004446 |