Benzeneacetic acid, a-hydroxy-a-phenyl-,[1-[(dimethylamino)methyl]cyclopropyl]methyl ester structure
|
Common Name | Benzeneacetic acid, a-hydroxy-a-phenyl-,[1-[(dimethylamino)methyl]cyclopropyl]methyl ester | ||
|---|---|---|---|---|
| CAS Number | 39943-09-4 | Molecular Weight | 339.42800 | |
| Density | 1.159g/cm3 | Boiling Point | 418.2ºC at 760mmHg | |
| Molecular Formula | C21H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | [1-[(dimethylamino)methyl]cyclopropyl]methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 418.2ºC at 760mmHg |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.42800 |
| Flash Point | 206.7ºC |
| Exact Mass | 339.18300 |
| PSA | 49.77000 |
| LogP | 2.80750 |
| Index of Refraction | 1.578 |
| InChIKey | AZSSUEWEOBTFHV-UHFFFAOYSA-N |
| SMILES | CN(C)CC1(COC(=O)C(O)(c2ccccc2)c2ccccc2)CC1 |
|
~%
Benzeneacetic a... CAS#:39943-09-4 |
| Literature: Newman; Broger; LaPidus; Tye Journal of medicinal chemistry, 1972 , vol. 15, # 10 p. 1003 - 1006 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| [1-(dimethylaminomethyl)cyclopropyl]methyl 2-hydroxy-2,2-diphenylacetate |