Benzeneacetic acid, a-hydroxy-a-phenyl-,[1-[(dimethylamino)methyl]cyclobutyl]methyl ester structure
|
Common Name | Benzeneacetic acid, a-hydroxy-a-phenyl-,[1-[(dimethylamino)methyl]cyclobutyl]methyl ester | ||
|---|---|---|---|---|
| CAS Number | 39943-10-7 | Molecular Weight | 353.45500 | |
| Density | 1.138g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C22H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | [1-[(dimethylamino)methyl]cyclobutyl]methyl 2-hydroxy-2,2-diphenylacetate |
|---|
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.45500 |
| Flash Point | 215.9ºC |
| Exact Mass | 353.19900 |
| PSA | 49.77000 |
| LogP | 3.19760 |
| Index of Refraction | 1.569 |
| InChIKey | YPQWYTVSMVEGPY-UHFFFAOYSA-N |
| SMILES | CN(C)CC1(COC(=O)C(O)(c2ccccc2)c2ccccc2)CCC1 |
|
~%
Benzeneacetic a... CAS#:39943-10-7 |
| Literature: Newman; Broger; LaPidus; Tye Journal of medicinal chemistry, 1972 , vol. 15, # 10 p. 1003 - 1006 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |