3-Nitro-4-fluorobenzoyl chloride structure
|
Common Name | 3-Nitro-4-fluorobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 400-94-2 | Molecular Weight | 203.55500 | |
| Density | 1.543g/cm3 | Boiling Point | 281.4ºC at 760mmHg | |
| Molecular Formula | C7H3ClFNO3 | Melting Point | 25-27.5ºC | |
| MSDS | N/A | Flash Point | 124ºC | |
| Name | 4-fluoro-3-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.543g/cm3 |
|---|---|
| Boiling Point | 281.4ºC at 760mmHg |
| Melting Point | 25-27.5ºC |
| Molecular Formula | C7H3ClFNO3 |
| Molecular Weight | 203.55500 |
| Flash Point | 124ºC |
| Exact Mass | 202.97900 |
| PSA | 62.89000 |
| LogP | 2.63610 |
| Vapour Pressure | 0.00357mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | OJNVFOHHRJZBEG-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(F)c([N+](=O)[O-])c1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-NITRO-4-FLUOROBENZOYL CHLORIDE |
| 4-fluoro-5-nitrobenzoyl chloride |
| 4-Fluor-3-nitro-benzoylchlorid |
| 4-fluoro-3-nitro-benzoyl chloride |
| 4-fluoro-3-nitro-1-benzenecarbonyl chloride |
| Benzoyl chloride,4-fluoro-3-nitro |
| CK1091 |