1-Iodo-2-nitro-4-(trifluoromethyl)benzene structure
|
Common Name | 1-Iodo-2-nitro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 400-97-5 | Molecular Weight | 317.004 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 261.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H3F3INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.7±27.3 °C | |
| Name | 1-Iodo-2-nitro-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 261.0±40.0 °C at 760 mmHg |
| Molecular Formula | C7H3F3INO2 |
| Molecular Weight | 317.004 |
| Flash Point | 111.7±27.3 °C |
| Exact Mass | 316.916046 |
| PSA | 45.82000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | CIDKWMAVWQNYNV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1I |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2904909090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: Phenotypic Assay to Identify Small Molecules that Upregulate Production of hCFTR in H...
Source: Southern Research Institute
Target: CFTR
External Id: CF Folding
|
| 1-Iodo-2-nitro-4-(trifluoromethyl)benzene |
| 1-iodo-2-nitro-4-trifluoromethyl-benzene |
| 1-Jod-2-nitro-4-trifluormethyl-benzol |
| 4-IODO-3-NITROBENZOTRIFLUORIDE |
| 4-Iodo-3-nitrobenzotrifluorid |
| 2-nitro-4-trifluoromethyliodobenzene |
| Benzene,1-iodo-2-nitro-4-(trifluoromethyl) |