1-Methylcyclopentyl (4-nitrophenyl) carbonate
Modify Date: 2025-09-04 11:23:52
1-Methylcyclopentyl (4-nitrophenyl) carbonate structure
|
Common Name | 1-Methylcyclopentyl (4-nitrophenyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 40044-41-5 | Molecular Weight | 265.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Methylcyclopentyl (4-nitrophenyl) carbonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO5 |
|---|---|
| Molecular Weight | 265.26 |
| InChIKey | MFYQYFQEUQMBRJ-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)Oc2ccc([N+](=O)[O-])cc2)CCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Methylcyclopentyl (4-nitrophenyl) carbonate? |
| A: InChIKey of 1-Methylcyclopentyl (4-nitrophenyl) carbonate is MFYQYFQEUQMBRJ-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Methylcyclopentyl (4-nitrophenyl) carbonate? |
| A: The English name of 1-Methylcyclopentyl (4-nitrophenyl) carbonate is 1-Methylcyclopentyl (4-nitrophenyl) carbonate. |
| Q: What is the molecular weight of 1-Methylcyclopentyl (4-nitrophenyl) carbonate? |
| A: Molecular weight of 1-Methylcyclopentyl (4-nitrophenyl) carbonate is 265.26. |
| Q: What is the Chinese name of 40044-41-5? |
| A: Chinese name of 40044-41-5 is 40044-41-5. |
| Q: What is the SMILES notation of 1-Methylcyclopentyl (4-nitrophenyl) carbonate? |
| A: SMILES notation of 1-Methylcyclopentyl (4-nitrophenyl) carbonate is CC1(OC(=O)Oc2ccc([N+](=O)[O-])cc2)CCCC1. |
| Q: What is the molecular formula of 1-Methylcyclopentyl (4-nitrophenyl) carbonate? |
| A: Molecular formula of 1-Methylcyclopentyl (4-nitrophenyl) carbonate is C13H15NO5. |
| Q: What is the CAS number of 1-Methylcyclopentyl (4-nitrophenyl) carbonate? |
| A: CAS number of 1-Methylcyclopentyl (4-nitrophenyl) carbonate is 40044-41-5. |