(R)-TERT-BUTYL (2-AMINO-3-PHENYLPROPYL)CARBAMATE structure
|
Common Name | (R)-TERT-BUTYL (2-AMINO-3-PHENYLPROPYL)CARBAMATE | ||
|---|---|---|---|---|
| CAS Number | 400652-57-5 | Molecular Weight | 250.337 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 392.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.9±25.9 °C | |
| Name | tert-butyl N-[(2R)-2-amino-3-phenylpropyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.1±35.0 °C at 760 mmHg |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.337 |
| Flash Point | 190.9±25.9 °C |
| Exact Mass | 250.168121 |
| PSA | 64.35000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | ADVSLLRGGNVROC-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(N)Cc1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-[(2R)-2-amino-3-phenylpropyl]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl [(2R)-2-amino-3-phenylpropyl]carbamate |
| Carbamic acid, [(2R)-2-amino-3-phenylpropyl]-, 1,1-dimethylethyl ester (9CI) |