3-(trifluoromethyl)benzamidoxime structure
|
Common Name | 3-(trifluoromethyl)benzamidoxime | ||
|---|---|---|---|---|
| CAS Number | 40067-80-9 | Molecular Weight | 204.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7F3N2O | Melting Point | 87-90 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N'-Hydroxy-3-(trifluoromethyl)-benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 87-90 °C(lit.) |
|---|---|
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.14900 |
| Exact Mass | 204.05100 |
| PSA | 58.61000 |
| LogP | 2.50020 |
| InChIKey | SBGBSARAGZEWGI-UHFFFAOYSA-N |
| SMILES | NC(=NO)c1cccc(C(F)(F)F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
|
~98%
3-(trifluoromet... CAS#:40067-80-9 |
| Literature: Reichert, Anja; Froehlich, Roland; Ferguson, Roderick; Kraft, Arno Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 11 p. 1321 - 1328 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
A novel and specific fluorescence reaction for uracil.
Anal. Chim. Acta 674(2) , 234-8, (2010) Facile and specific methods to quantify a nucleobase in biological samples are of great importance for diagnosing disorders in nucleic acid metabolism. In the present study, a novel fluorogenic reacti... |
| N'-hydroxy-3-(trifluoromethyl)benzenecarboximidamide |
| MFCD00068189 |