2,2',3,3',4,5',6-HEPTACHLOROBIPHENYL structure
|
Common Name | 2,2',3,3',4,5',6-HEPTACHLOROBIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 40186-70-7 | Molecular Weight | 395.32300 | |
| Density | 1.658 g/cm3 | Boiling Point | 410ºC at 760 mmHg | |
| Molecular Formula | C12H3Cl7 | Melting Point | 131.31°C (estimate) | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | 2,2',3,3',4,5',6-Heptachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.658 g/cm3 |
|---|---|
| Boiling Point | 410ºC at 760 mmHg |
| Melting Point | 131.31°C (estimate) |
| Molecular Formula | C12H3Cl7 |
| Molecular Weight | 395.32300 |
| Flash Point | 200.2ºC |
| Exact Mass | 391.80500 |
| LogP | 7.92740 |
| Index of Refraction | 1.632 |
| InChIKey | KJBDZJFSYQUNJT-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2c(Cl)cc(Cl)c(Cl)c2Cl)c1 |
| HS Code | 2903999090 |
|---|
|
~%
2,2',3,3',4,5',... CAS#:40186-70-7 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,3,5-tetrachloro-4-(2,3,5-trichlorophenyl)benzene |