Smac-N7 Peptide trifluoroacetate salt structure
|
Common Name | Smac-N7 Peptide trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 401913-57-3 | Molecular Weight | 725.87600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H59N9O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Smac-N7 Peptide trifluoroacetate saltSmac-N7 peptide, the seven N-terminal amino acid of the mitochondrial protein Smac (second mitochondria-derived activator of caspase), cannot pass through the cell membrane[1]. |
| Name | (2S)-6-amino-2-[[(2S)-5-amino-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoyl]amino]propanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Smac-N7 peptide, the seven N-terminal amino acid of the mitochondrial protein Smac (second mitochondria-derived activator of caspase), cannot pass through the cell membrane[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C33H59N9O9 |
|---|---|
| Molecular Weight | 725.87600 |
| Exact Mass | 725.44400 |
| PSA | 316.68000 |
| LogP | 4.63940 |
| InChIKey | ZGEOSZCDHUVWOC-SSHVMUOYSA-N |
| SMILES | CCC(C)C(NC(=O)C1CCCN1C(=O)C(NC(=O)C(C)N)C(C)C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(CCCCN)C(=O)O |
| L-Lysine,L-alanyl-L-valyl-L-prolyl-L-isoleucyl-L-alanyl-L-glutaminyl |
| Smac N7 Protein |
| AVPIAQK |