2-Nitro-5-(trifluoromethyl)aniline structure
|
Common Name | 2-Nitro-5-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 402-14-2 | Molecular Weight | 206.122 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 290.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H5F3N2O2 | Melting Point | 98-100°C | |
| MSDS | N/A | Flash Point | 129.5±27.3 °C | |
| Name | 2-Nitro-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.5±40.0 °C at 760 mmHg |
| Melting Point | 98-100°C |
| Molecular Formula | C7H5F3N2O2 |
| Molecular Weight | 206.122 |
| Flash Point | 129.5±27.3 °C |
| Exact Mass | 206.030319 |
| PSA | 71.84000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | AUTLVHYEAAAKNM-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)ccc1[N+](=O)[O-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2921420090 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Nitro-5-(trifluoromethyl)aniline |
| 3-Amino-4-nitrobenzitrifluoride |
| MFCD00042447 |