Isocyanuric Acid Tris(2-Acryloyloxyethyl) Ester
Modify Date: 2025-08-23 20:18:22
Isocyanuric Acid Tris(2-Acryloyloxyethyl) Ester structure
|
Common Name | Isocyanuric Acid Tris(2-Acryloyloxyethyl) Ester | ||
|---|---|---|---|---|
| CAS Number | 40220-08-4 | Molecular Weight | 423.374 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 568.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H21N3O9 | Melting Point | 52-53 ℃(lit.) | |
| MSDS | Chinese USA | Flash Point | 297.5±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Isocyanuric Acid Tris(2-Acryloyloxyethyl) Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 568.3±45.0 °C at 760 mmHg |
| Melting Point | 52-53 ℃(lit.) |
| Molecular Formula | C18H21N3O9 |
| Molecular Weight | 423.374 |
| Flash Point | 297.5±28.7 °C |
| Exact Mass | 423.127777 |
| PSA | 144.90000 |
| LogP | -0.26 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | YIJYFLXQHDOQGW-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCn1c(=O)n(CCOC(=O)C=C)c(=O)n(CCOC(=O)C=C)c1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| 2-Propenoic acid, (2,4,6-trioxo-1,3,5-triazine-1,3,5(2H,4H,6H)-triyl)tri-2,1-ethanediyl ester |
| Isocyanuric Acid Tris(2-acryloyloxyethyl) Ester |
| Tris(2-acryloyloxyethyl) Isocyanurate |
| (2,4,6-Trioxo-1,3,5-triazinane-1,3,5-triyl)triethane-2,1-diyl trisacrylate |
| (2,4,6-Trioxo-1,3,5-triazinane-1,3,5-triyl)tri-2,1-ethanediyl trisacrylate |
| MFCD00080669 |
| EINECS 254-843-6 |