[(3-Fluorophenyl)ethynyl](trimethyl)silane structure
|
Common Name | [(3-Fluorophenyl)ethynyl](trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 40230-96-4 | Molecular Weight | 192.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 207.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C11H13FSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 79.2±25.1 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 2-(3-fluorophenyl)ethynyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 207.4±32.0 °C at 760 mmHg |
| Molecular Formula | C11H13FSi |
| Molecular Weight | 192.305 |
| Flash Point | 79.2±25.1 °C |
| Exact Mass | 192.077057 |
| LogP | 4.51 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | NHSIZUNNAYOVMR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1cccc(F)c1 |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~%
[(3-Fluoropheny... CAS#:40230-96-4 |
| Literature: Desai, Bimbisar; Dixon, Karen; Farrant, Elizabeth; Feng, Qixing; Gibson, Karl R.; Van Hoorn, Willem P.; Mills, James; Morgan, Trevor; Parry, David M.; Ramjee, Manoj K.; Selway, Christopher N.; Tarver, Gary J.; Whitlock, Gavin; Wright, Adrian G. Journal of Medicinal Chemistry, 2013 , vol. 56, # 7 p. 3033 - 3047 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzene, 1-fluoro-3-[2-(trimethylsilyl)ethynyl]- |
| 2-(3-fluorophenyl)ethynyltrimethylsilane |
| MFCD03427263 |
| ((3-fluorophenyl)ethynyl)trimethylsilane |
| 1-[(Trimethylsilyl)ethynyl]-3-fluorobenzene |
| [(3-Fluorophenyl)ethynyl](trimethyl)silane |