N,N-DIMETHYL-4-((TRIMETHYLSILYL)ETHYNYL)ANILINE structure
|
Common Name | N,N-DIMETHYL-4-((TRIMETHYLSILYL)ETHYNYL)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 40230-97-5 | Molecular Weight | 217.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NSi | Melting Point | 86-90ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N,N-dimethyl-4-(2-trimethylsilylethynyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 86-90ºC(lit.) |
|---|---|
| Molecular Formula | C13H19NSi |
| Molecular Weight | 217.38200 |
| Exact Mass | 217.12900 |
| PSA | 3.24000 |
| LogP | 2.98150 |
| InChIKey | CTEFXFPTVUQSHR-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C#C[Si](C)(C)C)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
|
~99%
N,N-DIMETHYL-4-... CAS#:40230-97-5 |
| Literature: Elangovan, Arumugasamy; Wang, Yu-Hsiang; Ho, Tong-Ing Organic Letters, 2003 , vol. 5, # 11 p. 1841 - 1844 |
|
~91%
N,N-DIMETHYL-4-... CAS#:40230-97-5 |
| Literature: Leonard, Kristi A.; Nelen, Marina I.; Anderson, Linda T.; Gibson, Scott L.; Hilf, Russell; Detty, Michael R. Journal of Medicinal Chemistry, 1999 , vol. 42, # 19 p. 3942 - 3952 |
|
~%
N,N-DIMETHYL-4-... CAS#:40230-97-5 |
| Literature: Elangovan, Arumugasamy; Chen, Ting-Yu; Chen, Chih-Yuan; Ho, Tong-Ing Chemical Communications, 2003 , # 17 p. 2146 - 2147 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-N,N-dimethylaminophenyl)trimethylsilylethyne |
| 1-(4-dimethylaminophenyl)-2-trimethylsilylethyne |
| N,N-Dimethyl-4-((trimethylsilyl)ethynyl)aniline |
| dimethyl-(4-trimethylsilanylethynyl-phenyl)-amine |
| N,N-dimethyl(4-trimethylsilylethynylphenyl)amine |
| N,N-dimethyl-4-[(trimethylsilyl)ethynyl]benzeneamine |
| MFCD05664295 |