3,5-Dimethyl-4-nitro-1H-pyrrole-2-carbaldehyde structure
|
Common Name | 3,5-Dimethyl-4-nitro-1H-pyrrole-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 40236-20-2 | Molecular Weight | 168.150 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 307.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.8±27.9 °C | |
| Name | 3,5-Dimethyl-4-nitro-1H-pyrrole-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.5±42.0 °C at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 139.8±27.9 °C |
| Exact Mass | 168.053497 |
| PSA | 78.68000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | OOVLXRNEZYLZRL-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(C=O)c(C)c1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|
|
~99%
3,5-Dimethyl-4-... CAS#:40236-20-2 |
| Literature: Zhang, Long; Zheng, Qingmei; Yang, Yingying; Zhou, Haojie; Gong, Xingjiang; Zhao, Shuyong; Fan, Chuanwen European Journal of Medicinal Chemistry, 2014 , vol. 82, p. 139 - 151 |
|
~%
3,5-Dimethyl-4-... CAS#:40236-20-2 |
| Literature: Fischer; Beller; Stern Chemische Berichte, 1928 , vol. 61, p. 1082 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Formyl-3,5-dimethyl-4-nitropyrrol |
| 2-formyl-3,5-dimethyl-4-nitro-1-hydropyrrole |
| 3,5-Dimethyl-4-nitro-pyrrol-2-carbaldehyd |
| 3,5-dimethyl-4-nitro-pyrrole-2-carbaldehyde |
| 3,5-Dimethyl-4-nitro-1H-pyrrole-2-carbaldehyde |
| 2-formyl-3,5-dimethyl-4-nitro-1H-hydropyrrole |
| 3,5-dimethyl-4-nitro-pyrrol-2-carbaldehyde |
| 1H-Pyrrole-2-carboxaldehyde, 3,5-dimethyl-4-nitro- |