2-methyl-9,10-dioxo-anthracene-1-sulfonyl chloride structure
|
Common Name | 2-methyl-9,10-dioxo-anthracene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 4025-70-1 | Molecular Weight | 320.74800 | |
| Density | 1.512g/cm3 | Boiling Point | 523.7ºC at 760 mmHg | |
| Molecular Formula | C15H9ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.5ºC | |
| Name | 2-methyl-9,10-dioxoanthracene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.512g/cm3 |
|---|---|
| Boiling Point | 523.7ºC at 760 mmHg |
| Molecular Formula | C15H9ClO4S |
| Molecular Weight | 320.74800 |
| Flash Point | 270.5ºC |
| Exact Mass | 319.99100 |
| PSA | 76.66000 |
| LogP | 3.77870 |
| Vapour Pressure | 4.63E-11mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | UNKDMONJRYEFLO-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1S(=O)(=O)Cl)C(=O)c1ccccc1C2=O |
|
~%
2-methyl-9,10-d... CAS#:4025-70-1 |
| Literature: King,J.F. et al. Canadian Journal of Chemistry, 1963 , vol. 41, p. 100 - 107 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 2-Methyl-anthrachinon-sulfonsaeure-(1)-chlorid |
| 2-Methyl-anthraquinone-1-sulfonyl chloride |
| 2-methyl-9,10-dioxo-9,10-dihydroanthracene-1-sulfonyl chloride |
| 2-Methyl-9,10-dioxo-9,10-dihydro-anthracen-1-sulfonylchlorid |