9,10-dioxoanthracene-1-sulfonyl chloride structure
|
Common Name | 9,10-dioxoanthracene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 4025-69-8 | Molecular Weight | 306.72100 | |
| Density | 1.567g/cm3 | Boiling Point | 514.8ºC at 760 mmHg | |
| Molecular Formula | C14H7ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.2ºC | |
| Name | 9,10-dioxoanthracene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.567g/cm3 |
|---|---|
| Boiling Point | 514.8ºC at 760 mmHg |
| Molecular Formula | C14H7ClO4S |
| Molecular Weight | 306.72100 |
| Flash Point | 265.2ºC |
| Exact Mass | 305.97500 |
| PSA | 76.66000 |
| LogP | 3.47030 |
| Vapour Pressure | 1.04E-10mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | YRHBFXZMYZMWFO-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2S(=O)(=O)Cl |
| HS Code | 2914700090 |
|---|
|
~70%
9,10-dioxoanthr... CAS#:4025-69-8 |
| Literature: Armitage, Bruce; Yu, Changjun; Devadoss, Chelladurai; Schuster, Gary B. Journal of the American Chemical Society, 1994 , vol. 116, # 22 p. 9847 - 9859 |
|
~%
9,10-dioxoanthr... CAS#:4025-69-8 |
| Literature: Ullmann; Kertesz Chemische Berichte, 1919 , vol. 52, p. 555 |
|
~%
9,10-dioxoanthr... CAS#:4025-69-8 |
| Literature: Meyer,H.; Schlegl Monatshefte fuer Chemie, 1913 , vol. 34, p. 576 |
|
~%
9,10-dioxoanthr... CAS#:4025-69-8 |
| Literature: Meyer,H.; Schlegl Monatshefte fuer Chemie, 1913 , vol. 34, p. 576 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| anthraquinone-1-sulfonyl chloride |
| 9,10-Dioxo-9,10-dihydro-anthracen-1-sulfonylchlorid |
| Anthrachinon-1-sulfonylchlorid |
| 1-Anthraquinonesulfonyl chloride |
| anthraquinone-2-sulfonyl chloride |
| 9,10-dioxo-9,10-dihydro-anthracene-1-sulfonyl chloride |