ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate
Modify Date: 2025-08-25 13:05:12
![ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate Structure](https://image.chemsrc.com/caspic/263/402568-10-9.png)
ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate structure
|
Common Name | ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 402568-10-9 | Molecular Weight | 314.18100 | |
| Density | 1.399g/cm3 | Boiling Point | 276.3ºC at 760mmHg | |
| Molecular Formula | C12H8F6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.2ºC | |
| Name | ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-oxoacetate |
|---|
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 276.3ºC at 760mmHg |
| Molecular Formula | C12H8F6O3 |
| Molecular Weight | 314.18100 |
| Flash Point | 117.2ºC |
| Exact Mass | 314.03800 |
| PSA | 43.37000 |
| LogP | 3.47000 |
| Index of Refraction | 1.424 |
| InChIKey | ZOKKCCACHYBHRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2918300090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |