methyl 3-bromo-4-hydroxy-5-nitrobenzoate structure
|
Common Name | methyl 3-bromo-4-hydroxy-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 40258-72-8 | Molecular Weight | 276.04100 | |
| Density | 1.795g/cm3 | Boiling Point | 315.5ºC at 760 mmHg | |
| Molecular Formula | C8H6BrNO5 | Melting Point | 131-133ºC | |
| MSDS | N/A | Flash Point | 144.6ºC | |
| Name | methyl 3-bromo-4-hydroxy-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.795g/cm3 |
|---|---|
| Boiling Point | 315.5ºC at 760 mmHg |
| Melting Point | 131-133ºC |
| Molecular Formula | C8H6BrNO5 |
| Molecular Weight | 276.04100 |
| Flash Point | 144.6ºC |
| Exact Mass | 274.94300 |
| PSA | 92.35000 |
| LogP | 2.37270 |
| Index of Refraction | 1.621 |
| InChIKey | QVNQBMGIVJNPJH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)c(O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918290000 |
|
~%
methyl 3-bromo-... CAS#:40258-72-8 |
| Literature: Cavill Journal of the Society of Chemical Industry, London, 1945 , vol. 64, p. 212,214 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3-bromo-4-hydroxy-5-nitro-benzoic acid methyl ester |
| 3-Brom-4-hydroxy-5-nitro-benzoesaeure-methylester |
| EA-0875 |