trimethyl(1-trimethylsilylhex-1-yn-3-yl)silane structure
|
Common Name | trimethyl(1-trimethylsilylhex-1-yn-3-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 40276-92-4 | Molecular Weight | 226.50600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(1-trimethylsilylhex-1-yn-3-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H26Si2 |
|---|---|
| Molecular Weight | 226.50600 |
| Exact Mass | 226.15700 |
| LogP | 4.37570 |
| InChIKey | WKBZNBWTITTWCR-UHFFFAOYSA-N |
| SMILES | CCCC(C#C[Si](C)(C)C)[Si](C)(C)C |
|
~%
trimethyl(1-tri... CAS#:40276-92-4 |
| Literature: Lockhart, Thomas P.; Comita, Paul B.; Bergman, Robert G. Journal of the American Chemical Society, 1981 , vol. 103, # 14 p. 4082 - 4090 |
|
~%
trimethyl(1-tri... CAS#:40276-92-4 |
| Literature: Klein,J.; Becker,J.Y. Tetrahedron, 1972 , vol. 28, p. 5387 - 5392 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,3-bis(trimethylsilyl)hexyne |
| 1,3-bis(trimethylsilyl)-1-hexyne |
| Silane,(3-propyl-1-propyne-1,3-diyl)bis[trimethyl |