benzyl 4-nitrobenzenesulfonate structure
|
Common Name | benzyl 4-nitrobenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 4028-53-9 | Molecular Weight | 293.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 4-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11NO5S |
|---|---|
| Molecular Weight | 293.29500 |
| Exact Mass | 293.03600 |
| PSA | 97.57000 |
| LogP | 4.10430 |
| InChIKey | DAZXBAMNNWGCMH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OCc2ccccc2)cc1 |
| HS Code | 2906299090 |
|---|
|
~%
benzyl 4-nitrob... CAS#:4028-53-9 |
| Literature: Pasto, Daniel J.; Cottard, Francois; Jumelle, Laurent Journal of the American Chemical Society, 1994 , vol. 116, # 20 p. 8978 - 8984 |
|
~%
benzyl 4-nitrob... CAS#:4028-53-9 |
| Literature: Yoh, Soo-Dong; Tsuno, Yuho; Fujio, Mizue; Sawada, Masami; Yukawa, Yasuhide Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1989 , p. 7 - 14 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| benzyl p-nitrobenzenesulphonate |
| Benzyl-4-nitrobenzolsulfonat |
| Benzenesulfonic acid,4-nitro-,phenylmethyl ester |
| Benzyl-(p-nitro-benzolsulfonat) |