1-(1H-indol-3-yl)-2-phenyl-ethanone structure
|
Common Name | 1-(1H-indol-3-yl)-2-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 40281-54-7 | Molecular Weight | 235.28100 | |
| Density | 1.212g/cm3 | Boiling Point | 442.7ºC at 760 mmHg | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.4ºC | |
| Name | 1-(1H-indol-3-yl)-2-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 442.7ºC at 760 mmHg |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28100 |
| Flash Point | 226.4ºC |
| Exact Mass | 235.10000 |
| PSA | 32.86000 |
| LogP | 3.59330 |
| Index of Refraction | 1.676 |
| InChIKey | MVJGJYRFWKGPTI-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)c1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~64%
1-(1H-indol-3-y... CAS#:40281-54-7 |
| Literature: KATHOLIEKE UNIVERSITEIT LEUVEN; BARDIOT, Dorothée; CARLENS, Gunter; DALLMEIER, Kai; KAPTEIN, Suzanne; McNAUGHTON, Michael; MARCHAND, Arnaud; NEYTS, Johan; SMETS, Wim Patent: WO2013/45516 A1, 2013 ; Location in patent: Page/Page column 131; 135 ; |
|
~87%
1-(1H-indol-3-y... CAS#:40281-54-7 |
| Literature: ASTA Medica Aktiengesellschaft Patent: US5965582 A1, 1999 ; US 5965582 A |
|
~69%
1-(1H-indol-3-y... CAS#:40281-54-7 |
| Literature: Abdel-Motaleb, Ramadan Maawad; Makhloof, Abdel-Moneim Abdel-Salam; Ibrahim, Hamada Mohamed; Elnagdi, Mohamed Hilmy Journal of Heterocyclic Chemistry, 2007 , vol. 44, # 1 p. 109 - 114 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzyl-indol-3-yl-keton |
| 1-indol-3-yl-2-phenyl-ethanone |
| 3-Phenylacetylindol |
| 3-indolyl benzyl ketone |