2-Fluoro-4-nitrobenzoic acid structure
|
Common Name | 2-Fluoro-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 403-24-7 | Molecular Weight | 185.109 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 352.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H4FNO4 | Melting Point | 170 °C | |
| MSDS | N/A | Flash Point | 167.0±23.7 °C | |
| Name | 2-Fluoro-4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.5±27.0 °C at 760 mmHg |
| Melting Point | 170 °C |
| Molecular Formula | C7H4FNO4 |
| Molecular Weight | 185.109 |
| Flash Point | 167.0±23.7 °C |
| Exact Mass | 185.012436 |
| PSA | 83.12000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | MMWFMFZFCKADEL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1F |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S36/37/39-S22 |
| HS Code | 2916399090 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| WNR CF DVQ |
| 2-fluoro-4-nitrobenzoicacid |
| 2-Fluor-4-nitro-benzoesaeure |
| 4-Carboxy-3-fluoronitrobenzene |
| 2-fluoro-4-nitrobebzoic acid |
| 2-fluoro-4-nitrobenzenecarboxylic acid |
| MFCD00275565 |
| 2-Fluoro-4-nitrobenzoic acid |
| Benzoic acid, 2-fluoro-4-nitro- |