1-(Difluoromethyl)-3-nitro-benzene structure
|
Common Name | 1-(Difluoromethyl)-3-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 403-25-8 | Molecular Weight | 173.11700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(difluoromethyl)-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5F2NO2 |
|---|---|
| Molecular Weight | 173.11700 |
| Exact Mass | 173.02900 |
| PSA | 45.82000 |
| LogP | 3.05560 |
| InChIKey | QOGPXSPKXMNSLH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C(F)F)c1 |
| Storage condition | 2-8°C |
| HS Code | 2904909090 |
|---|
|
~99%
1-(Difluorometh... CAS#:403-25-8 |
| Literature: MERCK SHARP and DOHME CORP.; MERCK CANADA INC.; ALTMAN, Michael, D.; ANDRESEN, Brian, M.; ARRINGTON, Kenneth, L.; CHILDERS, Kaleen Konrad; DI FRANCESCO, Maria Emilia; DONOFRIO, Anthony; ELLIS, John Michael; FISCHER, Christian; GUERIN, David Joseph; HAIDLE, Andrew, M.; KATTAR, Solomon; KNOWLES, Sandra Lee; LI, Chaomin; LIM, Jongwon; MACHACEK, MIchelle, R.; NORTHRUP, Alan, B.; O'BOYLE, Brendan, M.; OTTE, Ryan, D.; PETROCCHI, Alessia; REUTERSHAN, Michael, H.; ROMEO, Eric; SIU, Tony; TAOKA, Brandon, M.; TROTTER, B. Wesley; ZHOU, Hua; BURCH, Jason; COTE, Bernard; DUPONT-GAUDET, Kristina; FOURNIER, Jean-Francois; GAUTHIER, Jacques Yves; GUAY, Daniel; ROBICHAUD, Joel, S.; GRIMM, Jonathan; MADDESS, Matthew, L.; SCHELL, Adam, J.; SPENCER, Kerrie, B.; WOO, Hyun Chong; BHAT, Sathesh Patent: WO2011/75515 A1, 2011 ; Location in patent: Page/Page column 262 ; |
|
~%
1-(Difluorometh... CAS#:403-25-8 |
| Literature: van Hove Chem. Zentralbl., 1914 , vol. 85, # I p. 1565 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Difluormethyl-3-nitro-benzol |
| 3-(difluoromethyl)nitrobenzene |
| 2,2-Difluor-3-nitro-toluol |
| 1-difluoromethyl-3-nitro-benzene |
| 1-Nitro-3-(difluoromethyl)benzene |
| Alpha,Alpha-Difluoro-3-nitrotoluene |