1-Isopropoxy-3-nitro-benzene structure
|
Common Name | 1-Isopropoxy-3-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 88991-53-1 | Molecular Weight | 181.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-3-propan-2-yloxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11NO3 |
|---|---|
| Molecular Weight | 181.18900 |
| Exact Mass | 181.07400 |
| PSA | 55.05000 |
| LogP | 2.90520 |
| InChIKey | HYEGHGPJOHWWEX-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cccc([N+](=O)[O-])c1 |
|
~86%
1-Isopropoxy-3-... CAS#:88991-53-1 |
| Literature: Yu; Thrasher; McCowan; Mason; Mendelsohn Journal of Medicinal Chemistry, 1991 , vol. 34, # 4 p. 1505 - 1508 |
|
~27%
1-Isopropoxy-3-... CAS#:88991-53-1 |
| Literature: Effenberger, Franz; Koch, Markus; Streicher, Willi Chemische Berichte, 1991 , vol. 124, # 1 p. 163 - 173 |
|
~10%
1-Isopropoxy-3-... CAS#:88991-53-1 |
| Literature: Bunce, Richard A.; Easton, Kerry M. Organic Preparations and Procedures International, 2004 , vol. 36, # 1 p. 76 - 81 |
| 3-(1-Methylethoxy)nitrobenzene |
| 3-isopropoxynitrobenzene |
| Benzene,1-(1-methylethoxy)-3-nitro |
| isopropyl-(3-nitro-phenyl)-ether |
| Isopropyl-(3-nitro-phenyl)-aether |
| 3-Nitro-1-isopropyloxy-benzol |
| 3-isopropoxy-1-nitrobenzene |
| 3-isopropoxy-3-nitrobenzol |