4-(Trifluoromethylthio)nitrobenzene structure
|
Common Name | 4-(Trifluoromethylthio)nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 403-66-7 | Molecular Weight | 223.17200 | |
| Density | 1.5 g/cm3 | Boiling Point | 201.4ºC at 760 mmHg | |
| Molecular Formula | C7H4F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-4-(trifluoromethylsulfanyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5 g/cm3 |
|---|---|
| Boiling Point | 201.4ºC at 760 mmHg |
| Molecular Formula | C7H4F3NO2S |
| Molecular Weight | 223.17200 |
| Exact Mass | 222.99100 |
| PSA | 71.12000 |
| LogP | 3.72990 |
| InChIKey | ILLBHPYCTYQBQI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(SC(F)(F)F)cc1 |
| HS Code | 2930909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| MFCD00041012 |
| 4-(Trifluoromethylthio)nitrobenzene |
| 4-NO2C6H4SCF3 |
| p-nitrophenyl trifluoromethyl sulfide |
| 4-nitrophenyltrifluoromethylsulfide |
| 1-nitro-4-(trifluoromethylthio)benzene |
| (4-nitrophenyl)(trifluoromethyl)sulfane |
| 1-nitro-4-[(trifluoromethyl)sulfanyl]benzene |
| p-trifluoromethylthionitrobenzene |