3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid
Modify Date: 2025-08-25 23:41:08
3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid structure
|
Common Name | 3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 40306-75-0 | Molecular Weight | 246.24000 | |
| Density | 1.686g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O5S | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Acetamido-5-amino-4-hydroxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.686g/cm3 |
|---|---|
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24000 |
| Exact Mass | 246.03100 |
| PSA | 138.10000 |
| LogP | 1.91450 |
| Index of Refraction | 1.681 |
| InChIKey | SFUJTLIHMWZDTL-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)O)cc(N)c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
3-(Acetylamino)... CAS#:40306-75-0 |
| Literature: Kalle and Co. Patent: DE182853 ; |
|
~%
3-(Acetylamino)... CAS#:40306-75-0 |
| Literature: Kalle and Co. Patent: DE182853 ; |
|
~%
3-(Acetylamino)... CAS#:40306-75-0 |
| Literature: Kalle and Co. Patent: DE182853 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-acetamido-5-amino-4-hydroxybenzenesulfonic acid |
| MFCD00035909 |
| 3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid |
| EINECS 254-879-2 |