8-hydroxy-7-methoxy-2-phenylchromen-4-one structure
|
Common Name | 8-hydroxy-7-methoxy-2-phenylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 40316-76-5 | Molecular Weight | 268.26400 | |
| Density | 1.329g/cm3 | Boiling Point | 464.6ºC at 760mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | 226-227ºC | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | 8-hydroxy-7-methoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 464.6ºC at 760mmHg |
| Melting Point | 226-227ºC |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26400 |
| Flash Point | 177.1ºC |
| Exact Mass | 268.07400 |
| PSA | 59.67000 |
| LogP | 3.17420 |
| Index of Refraction | 1.641 |
| InChIKey | YUFKWMXGTOJNRX-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)cc(-c3ccccc3)oc2c1O |
| HS Code | 2914509090 |
|---|
|
~%
8-hydroxy-7-met... CAS#:40316-76-5 |
| Literature: Baker Journal of the Chemical Society, 1939 , p. 956,959 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 8-hydroxy-7-methoxyflavone |
| 7-Methoxy-8-hydroxyflavon |
| 8-hydroxy-7-methoxy-2-phenyl-4H-chromen-4-one |
| 8-Hydroxy-7-methoxy-2-phenyl-chromen-4-on |
| 8-hydroxy-7-methoxyisoflavone |
| 8-hydroxy-7-methoxy-2-phenyl-chromen-4-one |