(s)-3-amino-4-(2-bromo-phenyl)-butyric acid hcl structure
|
Common Name | (s)-3-amino-4-(2-bromo-phenyl)-butyric acid hcl | ||
|---|---|---|---|---|
| CAS Number | 403661-76-7 | Molecular Weight | 294.573 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-3-Amino-4-(2-bromophenyl)-butanoic acid hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13BrClNO2 |
|---|---|
| Molecular Weight | 294.573 |
| Exact Mass | 292.981812 |
| PSA | 63.32000 |
| LogP | 3.29590 |
| InChIKey | CKWDUSDZVLBMMD-QRPNPIFTSA-N |
| SMILES | Cl.NC(CC(=O)O)Cc1ccccc1Br |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| rarechem ak pt f129 |
| (3S)-3-Amino-4-(2-bromophenyl)butanoic acid hydrochloride (1:1) |
| Benzenebutanoic acid, β-amino-2-bromo-, (βS)-, hydrochloride (1:1) |