5-[(4-hydroxy-3-methoxy-phenyl)methylidene]-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(4-hydroxy-3-methoxy-phenyl)methylidene]-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 40367-32-6 | Molecular Weight | 262.21800 | |
| Density | 1.471g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-hydroxy-3-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.21800 |
| Exact Mass | 262.05900 |
| PSA | 104.73000 |
| LogP | 0.80780 |
| Index of Refraction | 1.646 |
| InChIKey | HOHGWOUABYDGBN-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C2C(=O)NC(=O)NC2=O)ccc1O |
| HS Code | 2933540000 |
|---|
|
~98%
5-[(4-hydroxy-3... CAS#:40367-32-6 |
| Literature: Kaupp, Gerd; Naimi-Jamal, M. Reza; Schmeyers, Jens Tetrahedron, 2003 , vol. 59, # 21 p. 3753 - 3760 |
|
~0%
5-[(4-hydroxy-3... CAS#:40367-32-6 |
| Literature: Jalilzadeh, Mohammad; Pesyan, Nader Noroozi Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 9 p. 3382 - 3388 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-vanillylidene-barbituric acid |
| 5-(4-hydroxy-3-methoxybenzylidene)barbituric acid |
| 5-(4-hydroxy-3-methoxybenzylidene)pyrimidine-2,4,6(1H,3H,5H)-trione |
| 5-(4-hydroxy-3-methoxybenzylidene)pyrimidine-2,4,6-trione |
| 5-Vanillyliden-barbitursaeure |
| 5-[(4-hydroxy-3-methoxyphenyl)methylene]-2,4,6(1H,3H,5H)-pyrimidinetrione |