2H-Isoindole-2-aceticacid, a-formyl-1,3-dihydro-1,3-dioxo-,1,1-dimethylethyl ester structure
|
Common Name | 2H-Isoindole-2-aceticacid, a-formyl-1,3-dihydro-1,3-dioxo-,1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 40367-35-9 | Molecular Weight | 289.28300 | |
| Density | 1.305g/cm3 | Boiling Point | 406.7ºC at 760mmHg | |
| Molecular Formula | C15H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8ºC | |
| Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 406.7ºC at 760mmHg |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.28300 |
| Flash Point | 199.8ºC |
| Exact Mass | 289.09500 |
| PSA | 80.75000 |
| LogP | 1.12970 |
| Index of Refraction | 1.563 |
| InChIKey | AOUWUXDUCLLPTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C=O)N1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
|
~%
2H-Isoindole-2-... CAS#:40367-35-9 |
| Literature: Sheehan; Johnson Journal of the American Chemical Society, 1954 , vol. 76, p. 158 |
|
~%
2H-Isoindole-2-... CAS#:40367-35-9 |
| Literature: Sheehan; Johnson Journal of the American Chemical Society, 1954 , vol. 76, p. 158 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| tert-butyl 2-formyl-2-phthalimido-acetate |
| 3-oxo-2-phthalimido-propionic acid tert-butyl ester |
| 3-Oxo-2-phthalimido-propionsaeure-tert-butylester |
| tert-Butyl a-phthalimidomalonaldehydate |
| tert-Butyl-phthalimidomalonaldehydat |