Bis(triethoxysilylpropyl)tetrasulfide structure
|
Common Name | Bis(triethoxysilylpropyl)tetrasulfide | ||
|---|---|---|---|---|
| CAS Number | 40372-72-3 | Molecular Weight | 538.953 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 509.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H42O6S4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.0±32.9 °C | |
| Name | Bis[3-(Triethoxysilyl)Propyl]Tetrasulfide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 509.6±60.0 °C at 760 mmHg |
| Molecular Formula | C18H42O6S4Si2 |
| Molecular Weight | 538.953 |
| Flash Point | 262.0±32.9 °C |
| Exact Mass | 538.140259 |
| PSA | 156.58000 |
| LogP | 8.04 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | VTHOKNTVYKTUPI-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S23-S24/25 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~99%
Bis(triethoxysi... CAS#:40372-72-3 |
| Literature: Frings, Albert; Janssens, Louis; Lotter, Stefan; Deschler, Ulrich; Alig, Alfred Patent: US2007/66841 A1, 2007 ; Location in patent: Page/Page column 3-4 ; |
|
~%
Bis(triethoxysi... CAS#:40372-72-3 |
| Literature: Korth, Karsten; Kiefer, Ingo; Alig, Alfred; Deschler, Ulrich; Droege, Helmut; Koenigstein, Sefan; Schwan, Stephanie Patent: US2010/29971 A1, 2010 ; Location in patent: Page/Page column 10 ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Bis(triethoxysilylpropyl)tetrasulfide |
| 2O-SI-O2&O2&3SSSS3-SI-O2&O2&O2 |
| MFCD00053751 |
| Bis[3-(triethoxysilyl)propyl]tetrasulfide |
| 3,16-Dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy- |
| 3,3'-tetrathiobis(propyl-triethoxysilane) |
| 4,4,15,15-Tetraethoxy-3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane |
| triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane |
| EINECS 254-896-5 |
| Bis[3-(triethoxysilyl)propyl] tetrasulfide |