3,4-Dimethoxybenzophenone structure
|
Common Name | 3,4-Dimethoxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 4038-14-6 | Molecular Weight | 242.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 394.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.1±10.1 °C | |
| Name | (3,4-dimethoxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.7±27.0 °C at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 184.1±10.1 °C |
| Exact Mass | 242.094299 |
| PSA | 35.53000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | WCNOATOQNSHEFK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2)cc1OC |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Methanone, (3,4-dimethoxyphenyl)phenyl- |
| 3,4-dimethoxyphenyl phenyl ketone |
| 3,4-Dimethoxybenzophenone |
| 3,4-Dimethoxy-benzophenon |
| Methanone, (3-methoxyphenyl)(4-methoxyphenyl)- |
| MFCD00075875 |
| (3,4-Dimethoxyphenyl)-phenyl-methanon |
| 3,4-dimethoxy benzophenone |
| (3,4-Dimethoxyphenyl)(phenyl)methanone |
| (3-Methoxyphenyl)(4-methoxyphenyl)methanone |