(3,4-Dihydroxyphenyl)(phenyl)methanone structure
|
Common Name | (3,4-Dihydroxyphenyl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 10425-11-3 | Molecular Weight | 214.217 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 433.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | 144-148 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 230.3±22.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,4-Dihydroxybenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.8±35.0 °C at 760 mmHg |
| Melting Point | 144-148 °C(lit.) |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.217 |
| Flash Point | 230.3±22.4 °C |
| Exact Mass | 214.062988 |
| PSA | 57.53000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | ARWCZKJISXFBGI-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(O)c(O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914501900 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-Benzoylpyrocatechol |
| 3,4-dihydroxybnezophenone |
| MFCD00477203 |
| (3,4-Dihydroxyphenyl)(phenyl)methanone |
| 3,4-Dihydroxy-diphenyl ketone |
| 4-benzoylbenzene-1,2-diol |
| Methanone, (3,4-dihydroxyphenyl)phenyl- |
| 3,4-dihydroxy benzophonone |
| (3,4-Dihydroxyphenyl)phenylmethanone |
| 4-Benzoyl-brenzcatechin |
| 4-benzoylcatechol |
| 3,4-Dihydroxy-benzophenon |
| 3,4-Dihydroxybenzoph |