Methanone,(2,4-dimethoxyphenyl)(4-methoxyphenyl)- structure
|
Common Name | Methanone,(2,4-dimethoxyphenyl)(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 4038-15-7 | Molecular Weight | 272.29600 | |
| Density | 1.136g/cm3 | Boiling Point | 444ºC at 760mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | 71-73ºC | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | (2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760mmHg |
| Melting Point | 71-73ºC |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 197.9ºC |
| Exact Mass | 272.10500 |
| PSA | 44.76000 |
| LogP | 2.94340 |
| Vapour Pressure | 4.43E-08mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | VFTDVICZBGDMMB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(OC)cc2OC)cc1 |
| Storage condition | 2-8°C |
|
~%
Methanone,(2,4-... CAS#:4038-15-7 |
| Literature: Transitions Optical, Inc. Patent: US5466398 A1, 1995 ; |
|
~42%
Methanone,(2,4-... CAS#:4038-15-7 |
| Literature: Corning S.A. Patent: EP1038870 A1, 2000 ; |
|
~87%
Methanone,(2,4-... CAS#:4038-15-7 |
| Literature: Sharghi, Hashem; Tamaddon, Fatemeh Tetrahedron, 1996 , vol. 52, # 43 p. 13623 - 13640 |
|
~76%
Methanone,(2,4-... CAS#:4038-15-7 |
| Literature: Ahlburg, Andreas; Lindhardt, Anders T.; Taaning, Rolf. H.; Modvig, Amalie E.; Skrydstrup, Troels Journal of Organic Chemistry, 2013 , vol. 78, # 20 p. 10310 - 10318 |
|
~%
Methanone,(2,4-... CAS#:4038-15-7 |
| Literature: Tambor Chemische Berichte, 1910 , vol. 43, p. 1889 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00100089 |
| 2,4,4'-trimethoxy-benzophenone |
| 2,4,4'-Trimethoxy-benzophenon |
| 2,3-DIFLUOROPHENYLACETONITRILE |