4-ethyl-3-[(2-methylphenoxy)methyl]-1H-1,2,4-triazole-5-thione structure
|
Common Name | 4-ethyl-3-[(2-methylphenoxy)methyl]-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 403990-81-8 | Molecular Weight | 249.33200 | |
| Density | 1.23g/cm3 | Boiling Point | 350ºC at 760 mmHg | |
| Molecular Formula | C12H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.5ºC | |
| Name | 4-ethyl-3-[(2-methylphenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 350ºC at 760 mmHg |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.33200 |
| Flash Point | 165.5ºC |
| Exact Mass | 249.09400 |
| PSA | 78.74000 |
| LogP | 2.47410 |
| Index of Refraction | 1.62 |
| InChIKey | SKWYYPGBQTZOQF-UHFFFAOYSA-N |
| SMILES | CCn1c(COc2ccccc2C)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
4-ethyl-3-[(2-m... CAS#:403990-81-8 |
| Literature: Turan-Zitouni, Guelhan; Sivaci, Meltem; Kilic, Fatma S; Erol, Kevser European Journal of Medicinal Chemistry, 2001 , vol. 36, # 7-8 p. 685 - 689 |
|
~%
4-ethyl-3-[(2-m... CAS#:403990-81-8 |
| Literature: Turan-Zitouni, Guelhan; Sivaci, Meltem; Kilic, Fatma S; Erol, Kevser European Journal of Medicinal Chemistry, 2001 , vol. 36, # 7-8 p. 685 - 689 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |