1-(4-CHLOROPHENYL)-3-METHYL-1H-PYRAZOL-5-AMINE structure
|
Common Name | 1-(4-CHLOROPHENYL)-3-METHYL-1H-PYRAZOL-5-AMINE | ||
|---|---|---|---|---|
| CAS Number | 40401-39-6 | Molecular Weight | 207.65900 | |
| Density | 1.32g/cm3 | Boiling Point | 358.5ºC at 760 mmHg | |
| Molecular Formula | C10H10ClN3 | Melting Point | 108-112ºC(lit.) | |
| MSDS | USA | Flash Point | 170.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-chlorophenyl)-5-methylpyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 358.5ºC at 760 mmHg |
| Melting Point | 108-112ºC(lit.) |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.65900 |
| Flash Point | 170.6ºC |
| Exact Mass | 207.05600 |
| PSA | 43.84000 |
| LogP | 2.99750 |
| Index of Refraction | 1.643 |
| InChIKey | CLORQKXFDBKDCZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)n(-c2ccc(Cl)cc2)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
|
~69%
1-(4-CHLOROPHEN... CAS#:40401-39-6 |
| Literature: Marinozzi, Maura; Marcelli, Gloria; Carotti, Andrea; Natalini, Benedetto RSC Advances, 2014 , vol. 4, # 14 p. 7019 - 7023 |
|
~%
1-(4-CHLOROPHEN... CAS#:40401-39-6 |
| Literature: Ochiai, Hiroshi; Ishida, Akiharu; Ohtani, Tazumi; Kusumi, Kensuke; Kishikawa, Katuya; Yamamoto, Susumu; Takeda, Hiroshi; Obata, Takaaki; Nakai, Hisao; Toda, Masaaki Chemical and Pharmaceutical Bulletin, 2004 , vol. 52, # 9 p. 1098 - 1104 |
|
~%
1-(4-CHLOROPHEN... CAS#:40401-39-6 |
| Literature: Simay, A.; Takacs, K.; Horvath, K.; Dvortsak, P. Acta Chimica Academiae Scientiarum Hungaricae, 1980 , vol. 105, p. 127 - 140 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03478180 |
| EINECS 254-907-3 |
| 1-(4-Chlorophenyl)-3-methyl-1H-pyrazol-5-amine |
| 5-amino-3-methyl-1-p-chlorophenylpyrazole |
| 1-(4-Chlorophenyl)-3-methyl-1H-pyrazol-5-ylamine |