2-(2-Thienyl)ethyl 4-methylbenzenesulfonate structure
|
Common Name | 2-(2-Thienyl)ethyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 40412-06-4 | Molecular Weight | 282.379 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 433.2±33.0 °C at 760 mmHg | |
| Molecular Formula | C13H14O3S2 | Melting Point | 30.0 to 34.0 °C | |
| MSDS | N/A | Flash Point | 215.8±25.4 °C | |
| Name | 2-(Thiophen-2-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.2±33.0 °C at 760 mmHg |
| Melting Point | 30.0 to 34.0 °C |
| Molecular Formula | C13H14O3S2 |
| Molecular Weight | 282.379 |
| Flash Point | 215.8±25.4 °C |
| Exact Mass | 282.038422 |
| PSA | 79.99000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | HLPRKWVEMYDPAU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2cccs2)cc1 |
| HS Code | 2934999090 |
|---|
|
~99%
2-(2-Thienyl)et... CAS#:40412-06-4 |
| Literature: Sajja, Eswaraiah; Anumula, Raghupathi Reddy; Gilla, Goverdhan; Madivada, Lokeswara Rao Patent: US2007/225320 A1, 2007 ; Location in patent: Page/Page column 5 ; |
|
~%
2-(2-Thienyl)et... CAS#:40412-06-4 |
| Literature: G. D. Searle and Co. Patent: US4822775 A1, 1989 ; |
|
~86%
2-(2-Thienyl)et... CAS#:40412-06-4 |
| Literature: Ferraboschi, Patrizia; Mieri, Maria De; Galimberti, Fiorella Tetrahedron Asymmetry, 2010 , vol. 21, # 17 p. 2136 - 2141 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Thiopheneethanol, 4-methylbenzenesulfonate |
| 2-(2-Thienyl)ethyl p-Toluenesulfonate |
| 2-(2-Thienyl)ethyl 4-methylbenzenesulfonate |
| p-Toluenesulfonic Acid 2-(2-Thienyl)ethyl Ester |
| 2-(2-thienyl)ethyl toluene-p-sulphonate |
| 2-Thiopheneethanol Tosylate |