(4-chlorophenyl)-(3,4-dimethylphenyl)methanone structure
|
Common Name | (4-chlorophenyl)-(3,4-dimethylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 40415-10-9 | Molecular Weight | 244.71600 | |
| Density | 1.154g/cm3 | Boiling Point | 384.6ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | (4-chlorophenyl)-(3,4-dimethylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 384.6ºC at 760 mmHg |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.71600 |
| Flash Point | 214.2ºC |
| Exact Mass | 244.06500 |
| PSA | 17.07000 |
| LogP | 4.18780 |
| Index of Refraction | 1.58 |
| InChIKey | YMDVVGLPIKIHRX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2ccc(Cl)cc2)cc1C |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Chloro-3',4'-dimethylbenzophenone |