bis(4-iodophenyl)phosphinic acid structure
|
Common Name | bis(4-iodophenyl)phosphinic acid | ||
|---|---|---|---|---|
| CAS Number | 4042-67-5 | Molecular Weight | 469.98100 | |
| Density | 2.2g/cm3 | Boiling Point | 543.5ºC at 760 mmHg | |
| Molecular Formula | C12H9I2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.5ºC | |
| Name | bis(4-iodophenyl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2g/cm3 |
|---|---|
| Boiling Point | 543.5ºC at 760 mmHg |
| Molecular Formula | C12H9I2O2P |
| Molecular Weight | 469.98100 |
| Flash Point | 282.5ºC |
| Exact Mass | 469.84300 |
| PSA | 47.11000 |
| LogP | 3.11700 |
| Vapour Pressure | 1.21E-12mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | JNJMVYTYUAOJJE-UHFFFAOYSA-N |
| SMILES | O=P(O)(c1ccc(I)cc1)c1ccc(I)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Bis-<4-iod-phenyl>-phosphinsaeure |