Diethyl 3-oxoheptanedioate structure
|
Common Name | Diethyl 3-oxoheptanedioate | ||
|---|---|---|---|---|
| CAS Number | 40420-22-2 | Molecular Weight | 230.258 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 342.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 132.0±21.0 °C | |
| Name | diethyl 3-oxopimelate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.0±0.0 °C at 760 mmHg |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.258 |
| Flash Point | 132.0±21.0 °C |
| Exact Mass | 230.115417 |
| PSA | 69.67000 |
| LogP | 1.73 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.441 |
| InChIKey | RTMQRCLOAACETL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCC(=O)CC(=O)OCC |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
|
~%
Diethyl 3-oxohe... CAS#:40420-22-2 |
| Literature: Gelin,R.; Gelin,S. Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1964 , vol. 258, p. 4783 - 4784 |
|
~%
Diethyl 3-oxohe... CAS#:40420-22-2 |
| Literature: Guha,M. et al. Journal of the Indian Chemical Society, 1960 , vol. 37, p. 267 - 272 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
The chemistry of C-branched spermine tethered oligo-DNAs and their properties in forming duplexes and triplexes. Sund C, et al.
Nucleosides Nucleotides Nucleic Acids 16(5-6) , 755-60, (1997)
|
| Diethyl 3-oxoheptanedioate |
| EINECS 254-912-0 |
| Heptanedioic acid, 3-oxo-, diethyl ester |
| Diethyl 3-Oxopimelate |
| 3-Oxopimelic Acid Diethyl Ester |
| MFCD00009214 |
| 3-Oxoheptanedioic Acid Diethyl Ester |